C11H12NO2+ — CID 3658380
ethyl 1-prop-2-ynylpyridin-1-ium-3-carboxylate (PubChem CID 3658380) has the molecular formula C11H12NO2+ and a molecular weight of 190.22 g/mol. Its IUPAC name is ethyl 1-prop-2-ynylpyridin-1-ium-3-carboxylate.
| Compound Name | ethyl 1-prop-2-ynylpyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 3658380 |
| Molecular Formula | C11H12NO2+ |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | ethyl 1-prop-2-ynylpyridin-1-ium-3-carboxylate |
| SMILES | C#CC[n+]1cccc(C(=O)OCC)c1 |
| InChI | InChI=1S/C11H12NO2/c1-3-7-12-8-5-6-10(9-12)11(13)14-4-2/h1,5-6,8-9H,4,7H2,2H3/q+1 |
| InChIKey | VXKVOXYSURGUQJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|