C28H40BrN3O6+2 — CID 54603959
ethyl 1-(2-bromoethyl)piperidine-3-carboxylate;ethyl 1-[2-(3-ethoxycarbonylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium-3-carboxylate (PubChem CID 54603959) has the molecular formula C28H40BrN3O6+2 and a molecular weight of 594.55 g/mol. Its IUPAC name is ethyl 1-(2-bromoethyl)piperidine-3-carboxylate;ethyl 1-[2-(3-ethoxycarbonylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium-3-carboxylate.
| Compound Name | ethyl 1-(2-bromoethyl)piperidine-3-carboxylate;ethyl 1-[2-(3-ethoxycarbonylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 54603959 |
| Molecular Formula | C28H40BrN3O6+2 |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | ethyl 1-(2-bromoethyl)piperidine-3-carboxylate;ethyl 1-[2-(3-ethoxycarbonylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(CCBr)C1.CCOC(=O)c1ccc[n+](CC[n+]2cccc(C(=O)OCC)c2)c1 |
| InChI | InChI=1S/C18H22N2O4.C10H18BrNO2/c1-3-23-17(21)15-7-5-9-19(13-15)11-12-20-10-6-8-16(14-20)18(22)24-4-2;1-2-14-10(13)9-4-3-6-12(8-9)7-5-11/h5-10,13-14H,3-4,11-12H2,1-2H3;9H,2-8H2,1H3/q+2; |
| InChIKey | BBFAQZGQNGYSOJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 89.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|