C17H26ClNO2 — CID 6603291
ethyl 1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride (PubChem CID 6603291) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is ethyl 1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride.
| Compound Name | ethyl 1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 6603291 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | ethyl 1-(3-phenylpropyl)piperidine-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CCCN(CCCc2ccccc2)C1.Cl |
| InChI | InChI=1S/C17H25NO2.ClH/c1-2-20-17(19)16-11-7-13-18(14-16)12-6-10-15-8-4-3-5-9-15;/h3-5,8-9,16H,2,6-7,10-14H2,1H3;1H |
| InChIKey | GYXLPVSKCANQAC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |