About ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride
ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride (PubChem CID 117069127) has the molecular formula C20H40ClNO2
and a molecular weight of 362.00 g/mol. Its IUPAC name is ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride |
| PubChem CID | 117069127 |
| Molecular Formula | C20H40ClNO2 |
| Molecular Weight | 362.00 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride |
| SMILES | CCCCCCCCCCCCN1CCCC(C(=O)OCC)C1.Cl |
| InChI | InChI=1S/C20H39NO2.ClH/c1-3-5-6-7-8-9-10-11-12-13-16-21-17-14-15-19(18-21)20(22)23-4-2;/h19H,3-18H2,1-2H3;1H |
| InChIKey | CDNJJISSHWNHJG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.00 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride?
The IUPAC name of ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride (CID 117069127) is ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride?
The canonical SMILES for ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride is CCCCCCCCCCCCN1CCCC(C(=O)OCC)C1.Cl.
What is the InChIKey of ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride?
The InChIKey is CDNJJISSHWNHJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39NO2.ClH/c1-3-5-6-7-8-9-10-11-12-13-16-21-17-14-15-19(18-21)20(22)23-4-2;/h19H,3-18H2,1-2H3;1H.
What are the key properties of ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride?
ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride has a molecular weight of 362.00 g/mol, XLogP of 5.60, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-dodecylpiperidine-3-carboxylate;hydrochloride is sourced from PubChem (CID 117069127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).