C10H14IN2O3+ — CID 126957622
ethyl 1-(2-amino-2-oxoethyl)pyridin-1-ium-3-carboxylate;hydroiodide (PubChem CID 126957622) has the molecular formula C10H14IN2O3+ and a molecular weight of 337.14 g/mol. Its IUPAC name is ethyl 1-(2-amino-2-oxoethyl)pyridin-1-ium-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-(2-amino-2-oxoethyl)pyridin-1-ium-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 126957622 |
| Molecular Formula | C10H14IN2O3+ |
| Molecular Weight | 337.14 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | ethyl 1-(2-amino-2-oxoethyl)pyridin-1-ium-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)c1ccc[n+](CC(N)=O)c1.I |
| InChI | InChI=1S/C10H12N2O3.HI/c1-2-15-10(14)8-4-3-5-12(6-8)7-9(11)13;/h3-6H,2,7H2,1H3,(H-,11,13);1H/p+1 |
| InChIKey | XZFUXKTVBXSQCM-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.14 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|