C8H10BrN3O2 — CID 139196332
1-(2-amino-2-oxoethyl)pyridin-1-ium-3-carboxamide bromide (PubChem CID 139196332) has the molecular formula C8H10BrN3O2 and a molecular weight of 260.09 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)pyridin-1-ium-3-carboxamide bromide.
| Compound Name | 1-(2-amino-2-oxoethyl)pyridin-1-ium-3-carboxamide bromide |
|---|---|
| PubChem CID | 139196332 |
| Molecular Formula | C8H10BrN3O2 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)pyridin-1-ium-3-carboxamide bromide |
| SMILES | NC(=O)C[n+]1cccc(C(N)=O)c1.[Br-] |
| InChI | InChI=1S/C8H9N3O2.BrH/c9-7(12)5-11-3-1-2-6(4-11)8(10)13;/h1-4H,5H2,(H3-,9,10,12,13);1H |
| InChIKey | GMVURMOBCOXSTQ-UHFFFAOYSA-N |
| XLogP | -4.44 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|