C14H15ClN3O2+ — CID 126959733
1-(2-amino-2-oxoethyl)-N-phenylpyridin-1-ium-3-carboxamide;hydrochloride (PubChem CID 126959733) has the molecular formula C14H15ClN3O2+ and a molecular weight of 292.75 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)-N-phenylpyridin-1-ium-3-carboxamide;hydrochloride.
| Compound Name | 1-(2-amino-2-oxoethyl)-N-phenylpyridin-1-ium-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 126959733 |
| Molecular Formula | C14H15ClN3O2+ |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)-N-phenylpyridin-1-ium-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C[n+]1cccc(C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C14H13N3O2.ClH/c15-13(18)10-17-8-4-5-11(9-17)14(19)16-12-6-2-1-3-7-12;/h1-9H,10H2,(H2-,15,16,18,19);1H/p+1 |
| InChIKey | ZAHDVJKVCAJZKA-UHFFFAOYSA-O |
| XLogP | 1.13 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|