C21H21ClN4O4S — CID 10183080
2-[3-[(benzylsulfonylamino)carbamoyl]pyridin-1-ium-1-yl]-N-phenylacetamide chloride (PubChem CID 10183080) has the molecular formula C21H21ClN4O4S and a molecular weight of 460.94 g/mol. Its IUPAC name is 2-[3-[(benzylsulfonylamino)carbamoyl]pyridin-1-ium-1-yl]-N-phenylacetamide chloride.
| Compound Name | 2-[3-[(benzylsulfonylamino)carbamoyl]pyridin-1-ium-1-yl]-N-phenylacetamide chloride |
|---|---|
| PubChem CID | 10183080 |
| Molecular Formula | C21H21ClN4O4S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 2-[3-[(benzylsulfonylamino)carbamoyl]pyridin-1-ium-1-yl]-N-phenylacetamide chloride |
| SMILES | O=C(C[n+]1cccc(C(=O)NNS(=O)(=O)Cc2ccccc2)c1)Nc1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H20N4O4S.ClH/c26-20(22-19-11-5-2-6-12-19)15-25-13-7-10-18(14-25)21(27)23-24-30(28,29)16-17-8-3-1-4-9-17;/h1-14,24H,15-16H2,(H-,22,23,26,27);1H |
| InChIKey | KZJFQETVCNSGND-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|