C14H13N2O3+ — CID 11473170
1-(2-anilino-2-oxoethyl)pyridin-1-ium-3-carboxylic acid (PubChem CID 11473170) has the molecular formula C14H13N2O3+ and a molecular weight of 257.27 g/mol. Its IUPAC name is 1-(2-anilino-2-oxoethyl)pyridin-1-ium-3-carboxylic acid.
| Compound Name | 1-(2-anilino-2-oxoethyl)pyridin-1-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 11473170 |
| Molecular Formula | C14H13N2O3+ |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-(2-anilino-2-oxoethyl)pyridin-1-ium-3-carboxylic acid |
| SMILES | O=C(C[n+]1cccc(C(=O)O)c1)Nc1ccccc1 |
| InChI | InChI=1S/C14H12N2O3/c17-13(15-12-6-2-1-3-7-12)10-16-8-4-5-11(9-16)14(18)19/h1-9H,10H2,(H-,15,17,18,19)/p+1 |
| InChIKey | GKPWFHYDPUJHPA-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 70.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|