C14H12BrF3N2O — CID 11792963
1-[[4-(trifluoromethyl)phenyl]methyl](115N)pyridin-1-ium-3-carboxamide bromide (PubChem CID 11792963) has the molecular formula C14H12BrF3N2O and a molecular weight of 362.15 g/mol. Its IUPAC name is 1-[[4-(trifluoromethyl)phenyl]methyl](115N)pyridin-1-ium-3-carboxamide bromide.
| Compound Name | 1-[[4-(trifluoromethyl)phenyl]methyl](115N)pyridin-1-ium-3-carboxamide bromide |
|---|---|
| PubChem CID | 11792963 |
| Molecular Formula | C14H12BrF3N2O |
| Molecular Weight | 362.15 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1-[[4-(trifluoromethyl)phenyl]methyl](115N)pyridin-1-ium-3-carboxamide bromide |
| SMILES | NC(=O)c1ccc[15n+](Cc2ccc(C(F)(F)F)cc2)c1.[Br-] |
| InChI | InChI=1S/C14H11F3N2O.BrH/c15-14(16,17)12-5-3-10(4-6-12)8-19-7-1-2-11(9-19)13(18)20;/h1-7,9H,8H2,(H-,18,20);1H/i19+1; |
| InChIKey | QBQJLCYEUJYRQK-OQDUUNEASA-N |
| XLogP | -0.86 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.15 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|