C14H12FNO4 — CID 69331044
1-[(4-carboxyphenyl)methyl]pyridin-1-ium-3-carboxylic acid fluoride (PubChem CID 69331044) has the molecular formula C14H12FNO4 and a molecular weight of 277.25 g/mol. Its IUPAC name is 1-[(4-carboxyphenyl)methyl]pyridin-1-ium-3-carboxylic acid fluoride.
| Compound Name | 1-[(4-carboxyphenyl)methyl]pyridin-1-ium-3-carboxylic acid fluoride |
|---|---|
| PubChem CID | 69331044 |
| Molecular Formula | C14H12FNO4 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 1-[(4-carboxyphenyl)methyl]pyridin-1-ium-3-carboxylic acid fluoride |
| SMILES | O=C(O)c1ccc(C[n+]2cccc(C(=O)O)c2)cc1.[F-] |
| InChI | InChI=1S/C14H11NO4.FH/c16-13(17)11-5-3-10(4-6-11)8-15-7-1-2-12(9-15)14(18)19;/h1-7,9H,8H2,(H-,16,17,18,19);1H |
| InChIKey | BHVHMWBCUVQBEI-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|