C13H12NO6S+ — CID 123585005
4-[(3-sulfooxypyridin-1-ium-1-yl)methyl]benzoic acid (PubChem CID 123585005) has the molecular formula C13H12NO6S+ and a molecular weight of 310.31 g/mol. Its IUPAC name is 4-[(3-sulfooxypyridin-1-ium-1-yl)methyl]benzoic acid.
| Compound Name | 4-[(3-sulfooxypyridin-1-ium-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 123585005 |
| Molecular Formula | C13H12NO6S+ |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-[(3-sulfooxypyridin-1-ium-1-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C[n+]2cccc(OS(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C13H11NO6S/c15-13(16)11-5-3-10(4-6-11)8-14-7-1-2-12(9-14)20-21(17,18)19/h1-7,9H,8H2,(H-,15,16,17,18,19)/p+1 |
| InChIKey | IXZGUXWIEODZFD-UHFFFAOYSA-O |
| XLogP | 0.90 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|