C15H19N2O6P — CID 159443026
(1-benzylpyridin-1-ium-3-yl) N,N-dimethylcarbamate;dihydrogen phosphate (PubChem CID 159443026) has the molecular formula C15H19N2O6P and a molecular weight of 354.30 g/mol. Its IUPAC name is (1-benzylpyridin-1-ium-3-yl) N,N-dimethylcarbamate;dihydrogen phosphate.
| Compound Name | (1-benzylpyridin-1-ium-3-yl) N,N-dimethylcarbamate;dihydrogen phosphate |
|---|---|
| PubChem CID | 159443026 |
| Molecular Formula | C15H19N2O6P |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (1-benzylpyridin-1-ium-3-yl) N,N-dimethylcarbamate;dihydrogen phosphate |
| SMILES | CN(C)C(=O)Oc1ccc[n+](Cc2ccccc2)c1.O=P([O-])(O)O |
| InChI | InChI=1S/C15H17N2O2.H3O4P/c1-16(2)15(18)19-14-9-6-10-17(12-14)11-13-7-4-3-5-8-13;1-5(2,3)4/h3-10,12H,11H2,1-2H3;(H3,1,2,3,4)/q+1;/p-1 |
| InChIKey | LSKHMKRHGZMQCD-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|