C14H21N2O6S+ — CID 67233646
[3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxypyridin-1-ium-1-yl]methyl N,N-dimethylcarbamate (PubChem CID 67233646) has the molecular formula C14H21N2O6S+ and a molecular weight of 345.40 g/mol. Its IUPAC name is [3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxypyridin-1-ium-1-yl]methyl N,N-dimethylcarbamate.
| Compound Name | [3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxypyridin-1-ium-1-yl]methyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 67233646 |
| Molecular Formula | C14H21N2O6S+ |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxypyridin-1-ium-1-yl]methyl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OC[n+]1cccc(O[C@H]2SC[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C14H21N2O6S/c1-15(2)14(20)21-8-16-5-3-4-9(6-16)22-13-12(19)11(18)10(17)7-23-13/h3-6,10-13,17-19H,7-8H2,1-2H3/q+1/t10-,11+,12-,13+/m1/s1 |
| InChIKey | BPBHWOXYIFNCFJ-XQHKEYJVSA-N |
| XLogP | -0.84 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|