C10H12ClNO4S — CID 87318175
(2R,3R,4S,5S)-2-[(2-chloro-3-pyridinyl)oxy]thiane-3,4,5-triol (PubChem CID 87318175) has the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[(2-chloro-3-pyridinyl)oxy]thiane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[(2-chloro-3-pyridinyl)oxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 87318175 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | (2R,3R,4S,5S)-2-[(2-chloro-3-pyridinyl)oxy]thiane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](Oc2cccnc2Cl)SC[C@H]1O |
| InChI | InChI=1S/C10H12ClNO4S/c11-9-6(2-1-3-12-9)16-10-8(15)7(14)5(13)4-17-10/h1-3,5,7-8,10,13-15H,4H2/t5-,7+,8-,10-/m1/s1 |
| InChIKey | CIDIZRHVABWQLC-AMCGLFBUSA-N |
| XLogP | 0.27 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|