C18H17NO4S2 — CID 67396084
(2R,3R,4S,5S)-2-[2-(1,3-benzothiazol-2-yl)phenoxy]thiane-3,4,5-triol (PubChem CID 67396084) has the molecular formula C18H17NO4S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[2-(1,3-benzothiazol-2-yl)phenoxy]thiane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[2-(1,3-benzothiazol-2-yl)phenoxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 67396084 |
| Molecular Formula | C18H17NO4S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | (2R,3R,4S,5S)-2-[2-(1,3-benzothiazol-2-yl)phenoxy]thiane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](Oc2ccccc2-c2nc3ccccc3s2)SC[C@H]1O |
| InChI | InChI=1S/C18H17NO4S2/c20-12-9-24-18(16(22)15(12)21)23-13-7-3-1-5-10(13)17-19-11-6-2-4-8-14(11)25-17/h1-8,12,15-16,18,20-22H,9H2/t12-,15+,16-,18-/m1/s1 |
| InChIKey | BKISSSXQZNVHJM-BUIXCFAXSA-N |
| XLogP | 2.50 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |