C15H12N2OS — CID 174888047
1H-azirine;2-(1,3-benzothiazol-2-yl)phenol (PubChem CID 174888047) has the molecular formula C15H12N2OS and a molecular weight of 268.34 g/mol. Its IUPAC name is 1H-azirine;2-(1,3-benzothiazol-2-yl)phenol.
| Compound Name | 1H-azirine;2-(1,3-benzothiazol-2-yl)phenol |
|---|---|
| PubChem CID | 174888047 |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1H-azirine;2-(1,3-benzothiazol-2-yl)phenol |
| SMILES | C1=CN1.Oc1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H9NOS.C2H3N/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13;1-2-3-1/h1-8,15H;1-3H |
| InChIKey | CUHQWJOIFNLYIV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |