C18H13NOS — CID 142679253
2-(5-methoxynaphthalen-1-yl)-1,3-benzothiazole (PubChem CID 142679253) has the molecular formula C18H13NOS and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-(5-methoxynaphthalen-1-yl)-1,3-benzothiazole.
| Compound Name | 2-(5-methoxynaphthalen-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 142679253 |
| Molecular Formula | C18H13NOS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-(5-methoxynaphthalen-1-yl)-1,3-benzothiazole |
| SMILES | COc1cccc2c(-c3nc4ccccc4s3)cccc12 |
| InChI | InChI=1S/C18H13NOS/c1-20-16-10-5-6-12-13(16)7-4-8-14(12)18-19-15-9-2-3-11-17(15)21-18/h2-11H,1H3 |
| InChIKey | DLIAHYURCCKAQF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |