C16H15NO2S — CID 16766166
2-(2-ethoxy-3-methoxyphenyl)-1,3-benzothiazole (PubChem CID 16766166) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-(2-ethoxy-3-methoxyphenyl)-1,3-benzothiazole.
| Compound Name | 2-(2-ethoxy-3-methoxyphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 16766166 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(2-ethoxy-3-methoxyphenyl)-1,3-benzothiazole |
| SMILES | CCOc1c(OC)cccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H15NO2S/c1-3-19-15-11(7-6-9-13(15)18-2)16-17-12-8-4-5-10-14(12)20-16/h4-10H,3H2,1-2H3 |
| InChIKey | GOHLFXLJKPRJCQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |