C16H17NOSSi — CID 170680401
[2-(1,3-benzothiazol-2-yl)phenoxy]-trimethylsilane (PubChem CID 170680401) has the molecular formula C16H17NOSSi and a molecular weight of 299.47 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)phenoxy]-trimethylsilane.
| Compound Name | [2-(1,3-benzothiazol-2-yl)phenoxy]-trimethylsilane |
|---|---|
| PubChem CID | 170680401 |
| Molecular Formula | C16H17NOSSi |
| Molecular Weight | 299.47 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)phenoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)Oc1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H17NOSSi/c1-20(2,3)18-14-10-6-4-8-12(14)16-17-13-9-5-7-11-15(13)19-16/h4-11H,1-3H3 |
| InChIKey | VRQNWCUOEXMCSC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|