C13H16O5S — CID 15067861
1-[2-[(2R,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxyphenyl]ethanone (PubChem CID 15067861) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is 1-[2-[(2R,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxyphenyl]ethanone.
| Compound Name | 1-[2-[(2R,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxyphenyl]ethanone |
|---|---|
| PubChem CID | 15067861 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-[2-[(2R,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxyphenyl]ethanone |
| SMILES | CC(=O)c1ccccc1O[C@@H]1SC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H16O5S/c1-7(14)8-4-2-3-5-10(8)18-13-12(17)11(16)9(15)6-19-13/h2-5,9,11-13,15-17H,6H2,1H3/t9-,11+,12-,13-/m1/s1 |
| InChIKey | UZQFOIJEFYNVGY-GWNIPJSYSA-N |
| XLogP | 0.42 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |