C10H15ClN2O3 — CID 3052949
[1-(2-hydroxyethyl)pyridin-1-ium-3-yl] N,N-dimethylcarbamate chloride (PubChem CID 3052949) has the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. Its IUPAC name is [1-(2-hydroxyethyl)pyridin-1-ium-3-yl] N,N-dimethylcarbamate chloride.
| Compound Name | [1-(2-hydroxyethyl)pyridin-1-ium-3-yl] N,N-dimethylcarbamate chloride |
|---|---|
| PubChem CID | 3052949 |
| Molecular Formula | C10H15ClN2O3 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | [1-(2-hydroxyethyl)pyridin-1-ium-3-yl] N,N-dimethylcarbamate chloride |
| SMILES | CN(C)C(=O)Oc1ccc[n+](CCO)c1.[Cl-] |
| InChI | InChI=1S/C10H15N2O3.ClH/c1-11(2)10(14)15-9-4-3-5-12(8-9)6-7-13;/h3-5,8,13H,6-7H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NXTLDOVTBCOKRD-UHFFFAOYSA-M |
| XLogP | -2.97 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|