C9H12IN2O2+ — CID 3039941
(2-iodo-1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate (PubChem CID 3039941) has the molecular formula C9H12IN2O2+ and a molecular weight of 307.11 g/mol. Its IUPAC name is (2-iodo-1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate.
| Compound Name | (2-iodo-1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 3039941 |
| Molecular Formula | C9H12IN2O2+ |
| Molecular Weight | 307.11 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | (2-iodo-1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc[n+](C)c1I |
| InChI | InChI=1S/C9H12IN2O2/c1-11(2)9(13)14-7-5-4-6-12(3)8(7)10/h4-6H,1-3H3/q+1 |
| InChIKey | VKRVZBZBUOPLBV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.11 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|