C16H20N3O2+ — CID 3051447
[4-[methyl-(1-methylpyridin-1-ium-2-yl)amino]phenyl] N,N-dimethylcarbamate (PubChem CID 3051447) has the molecular formula C16H20N3O2+ and a molecular weight of 286.36 g/mol. Its IUPAC name is [4-[methyl-(1-methylpyridin-1-ium-2-yl)amino]phenyl] N,N-dimethylcarbamate.
| Compound Name | [4-[methyl-(1-methylpyridin-1-ium-2-yl)amino]phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 3051447 |
| Molecular Formula | C16H20N3O2+ |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [4-[methyl-(1-methylpyridin-1-ium-2-yl)amino]phenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc(N(C)c2cccc[n+]2C)cc1 |
| InChI | InChI=1S/C16H20N3O2/c1-17(2)16(20)21-14-10-8-13(9-11-14)19(4)15-7-5-6-12-18(15)3/h5-12H,1-4H3/q+1 |
| InChIKey | HDLAFZATZDBEHB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|