C13H18N2O2 — CID 67304885
(4-pyrrolidin-1-ylphenyl) N,N-dimethylcarbamate (PubChem CID 67304885) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (4-pyrrolidin-1-ylphenyl) N,N-dimethylcarbamate.
| Compound Name | (4-pyrrolidin-1-ylphenyl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 67304885 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (4-pyrrolidin-1-ylphenyl) N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C13H18N2O2/c1-14(2)13(16)17-12-7-5-11(6-8-12)15-9-3-4-10-15/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | BWICBKWTSNKWKF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |