ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid

C14H19NO3 — CID 144811360

IUPACethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid
SMILESCC.O=C(O)C(=O)c1ccc(N2CCCC2)cc1
InChIInChI=1S/C12H13NO3.C2H6/c14-11(12(15)16)9-3-5-10(6-4-9)13-7-1-2-8-13;1-2/h3-6H,1-2,7-8H2,(H,15,16);1-2H3
InChIKeyVHMUAXAUMJWBPS-UHFFFAOYSA-N
MW249.31 g/mol
LogP2.58
Rot. Bonds3

About ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid

ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid (PubChem CID 144811360) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid.

Molecular Properties

Compound Nameethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid
PubChem CID144811360
Molecular FormulaC14H19NO3
Molecular Weight249.31 g/mol
Exact Mass249.14
IUPAC Nameethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid
SMILESCC.O=C(O)C(=O)c1ccc(N2CCCC2)cc1
InChIInChI=1S/C12H13NO3.C2H6/c14-11(12(15)16)9-3-5-10(6-4-9)13-7-1-2-8-13;1-2/h3-6H,1-2,7-8H2,(H,15,16);1-2H3
InChIKeyVHMUAXAUMJWBPS-UHFFFAOYSA-N
XLogP2.58
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 52.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid?
The IUPAC name of ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid (CID 144811360) is ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid.
What is the SMILES notation for ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid?
The canonical SMILES for ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid is CC.O=C(O)C(=O)c1ccc(N2CCCC2)cc1.
What is the InChIKey of ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid?
The InChIKey is VHMUAXAUMJWBPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3.C2H6/c14-11(12(15)16)9-3-5-10(6-4-9)13-7-1-2-8-13;1-2/h3-6H,1-2,7-8H2,(H,15,16);1-2H3.
What are the key properties of ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid?
ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid has a molecular weight of 249.31 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-oxo-2-(4-pyrrolidin-1-ylphenyl)acetic acid is sourced from PubChem (CID 144811360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).