C12H10N2O5 — CID 117409635
2-[4-(3,5-dioxopiperazin-1-yl)phenyl]-2-oxoacetic acid (PubChem CID 117409635) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 2-[4-(3,5-dioxopiperazin-1-yl)phenyl]-2-oxoacetic acid.
| Compound Name | 2-[4-(3,5-dioxopiperazin-1-yl)phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 117409635 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-[4-(3,5-dioxopiperazin-1-yl)phenyl]-2-oxoacetic acid |
| SMILES | O=C1CN(c2ccc(C(=O)C(=O)O)cc2)CC(=O)N1 |
| InChI | InChI=1S/C12H10N2O5/c15-9-5-14(6-10(16)13-9)8-3-1-7(2-4-8)11(17)12(18)19/h1-4H,5-6H2,(H,18,19)(H,13,15,16) |
| InChIKey | RGIAQPUVPDIVHU-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|