C22H33NO2 — CID 102132847
(4-pyrrolidin-1-ylphenyl) 4-pentylcyclohexane-1-carboxylate (PubChem CID 102132847) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (4-pyrrolidin-1-ylphenyl) 4-pentylcyclohexane-1-carboxylate.
| Compound Name | (4-pyrrolidin-1-ylphenyl) 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 102132847 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (4-pyrrolidin-1-ylphenyl) 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)Oc2ccc(N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H33NO2/c1-2-3-4-7-18-8-10-19(11-9-18)22(24)25-21-14-12-20(13-15-21)23-16-5-6-17-23/h12-15,18-19H,2-11,16-17H2,1H3 |
| InChIKey | WGMKONMITBXCNR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|