C15H22N2O2 — CID 13483047
(3-pyrrolidin-1-ylphenyl) N,N-diethylcarbamate (PubChem CID 13483047) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (3-pyrrolidin-1-ylphenyl) N,N-diethylcarbamate.
| Compound Name | (3-pyrrolidin-1-ylphenyl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 13483047 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (3-pyrrolidin-1-ylphenyl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-3-16(4-2)15(18)19-14-9-7-8-13(12-14)17-10-5-6-11-17/h7-9,12H,3-6,10-11H2,1-2H3 |
| InChIKey | BGACMCYWCWMVPS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |