C17H24N2O — CID 175014113
N,N-diethyl-3-(4-pyrrolidin-1-ylphenyl)prop-2-enamide (PubChem CID 175014113) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N,N-diethyl-3-(4-pyrrolidin-1-ylphenyl)prop-2-enamide.
| Compound Name | N,N-diethyl-3-(4-pyrrolidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 175014113 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N,N-diethyl-3-(4-pyrrolidin-1-ylphenyl)prop-2-enamide |
| SMILES | CCN(CC)C(=O)C=Cc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C17H24N2O/c1-3-18(4-2)17(20)12-9-15-7-10-16(11-8-15)19-13-5-6-14-19/h7-12H,3-6,13-14H2,1-2H3 |
| InChIKey | HZHDPPRWNOQAER-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|