C16H23N3O2 — CID 108986203
N',N'-diethyl-N-(4-pyrrolidin-1-ylphenyl)oxamide (PubChem CID 108986203) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N',N'-diethyl-N-(4-pyrrolidin-1-ylphenyl)oxamide.
| Compound Name | N',N'-diethyl-N-(4-pyrrolidin-1-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108986203 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N',N'-diethyl-N-(4-pyrrolidin-1-ylphenyl)oxamide |
| SMILES | CCN(CC)C(=O)C(=O)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C16H23N3O2/c1-3-18(4-2)16(21)15(20)17-13-7-9-14(10-8-13)19-11-5-6-12-19/h7-10H,3-6,11-12H2,1-2H3,(H,17,20) |
| InChIKey | IOBYUHZNVMCYGP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|