C17H27N3O — CID 109030656
N,N-diethyl-3-(4-pyrrolidin-1-ylanilino)propanamide (PubChem CID 109030656) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is N,N-diethyl-3-(4-pyrrolidin-1-ylanilino)propanamide.
| Compound Name | N,N-diethyl-3-(4-pyrrolidin-1-ylanilino)propanamide |
|---|---|
| PubChem CID | 109030656 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | N,N-diethyl-3-(4-pyrrolidin-1-ylanilino)propanamide |
| SMILES | CCN(CC)C(=O)CCNc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C17H27N3O/c1-3-19(4-2)17(21)11-12-18-15-7-9-16(10-8-15)20-13-5-6-14-20/h7-10,18H,3-6,11-14H2,1-2H3 |
| InChIKey | TXZAMSNZXCWJAC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|