C12H16N2O2 — CID 14925038
N',N'-diethyl-N-phenyloxamide (PubChem CID 14925038) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N',N'-diethyl-N-phenyloxamide.
| Compound Name | N',N'-diethyl-N-phenyloxamide |
|---|---|
| PubChem CID | 14925038 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N',N'-diethyl-N-phenyloxamide |
| SMILES | CCN(CC)C(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H16N2O2/c1-3-14(4-2)12(16)11(15)13-10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | OQDRJPBLKJMYIG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|