C20H16N2O2 — CID 54357836
N,N',N'-triphenyloxamide (PubChem CID 54357836) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is N,N',N'-triphenyloxamide.
| Compound Name | N,N',N'-triphenyloxamide |
|---|---|
| PubChem CID | 54357836 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N,N',N'-triphenyloxamide |
| SMILES | O=C(Nc1ccccc1)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O2/c23-19(21-16-10-4-1-5-11-16)20(24)22(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,(H,21,23) |
| InChIKey | UKJMIOPFHFPSTQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|