About N'-hydroxy-N-phenyloxamide
N'-hydroxy-N-phenyloxamide (PubChem CID 5008441) has the molecular formula C8H8N2O3
and a molecular weight of 180.16 g/mol. Its IUPAC name is N'-hydroxy-N-phenyloxamide.
Molecular Properties
| Compound Name | N'-hydroxy-N-phenyloxamide |
| PubChem CID | 5008441 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | N'-hydroxy-N-phenyloxamide |
| SMILES | O=C(NO)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C8H8N2O3/c11-7(8(12)10-13)9-6-4-2-1-3-5-6/h1-5,13H,(H,9,11)(H,10,12) |
| InChIKey | RQBQUIBOICCAAM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-N-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-N-phenyloxamide?
The IUPAC name of N'-hydroxy-N-phenyloxamide (CID 5008441) is N'-hydroxy-N-phenyloxamide.
What is the SMILES notation for N'-hydroxy-N-phenyloxamide?
The canonical SMILES for N'-hydroxy-N-phenyloxamide is O=C(NO)C(=O)Nc1ccccc1.
What is the InChIKey of N'-hydroxy-N-phenyloxamide?
The InChIKey is RQBQUIBOICCAAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3/c11-7(8(12)10-13)9-6-4-2-1-3-5-6/h1-5,13H,(H,9,11)(H,10,12).
What are the key properties of N'-hydroxy-N-phenyloxamide?
N'-hydroxy-N-phenyloxamide has a molecular weight of 180.16 g/mol, XLogP of 0.13, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-N-phenyloxamide is sourced from PubChem (CID 5008441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).