C20H17N3O2 — CID 71359478
1,1-diphenyl-3-(phenylcarbamoyl)urea (PubChem CID 71359478) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 1,1-diphenyl-3-(phenylcarbamoyl)urea.
| Compound Name | 1,1-diphenyl-3-(phenylcarbamoyl)urea |
|---|---|
| PubChem CID | 71359478 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 1,1-diphenyl-3-(phenylcarbamoyl)urea |
| SMILES | O=C(NC(=O)N(c1ccccc1)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C20H17N3O2/c24-19(21-16-10-4-1-5-11-16)22-20(25)23(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,(H2,21,22,24,25) |
| InChIKey | VYZRMUBHPVEZDV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |