C10H13N3O3 — CID 24738766
1-(2-hydroxyethyl)-3-(phenylcarbamoyl)urea (PubChem CID 24738766) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(phenylcarbamoyl)urea.
| Compound Name | 1-(2-hydroxyethyl)-3-(phenylcarbamoyl)urea |
|---|---|
| PubChem CID | 24738766 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(phenylcarbamoyl)urea |
| SMILES | O=C(NCCO)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C10H13N3O3/c14-7-6-11-9(15)13-10(16)12-8-4-2-1-3-5-8/h1-5,14H,6-7H2,(H3,11,12,13,15,16) |
| InChIKey | MCKVYGNSYYXKRG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |