C12H16N4O2S — CID 54294265
methyl N'-(dimethylcarbamoyl)-N-(phenylcarbamoyl)carbamimidothioate (PubChem CID 54294265) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is methyl N'-(dimethylcarbamoyl)-N-(phenylcarbamoyl)carbamimidothioate.
| Compound Name | methyl N'-(dimethylcarbamoyl)-N-(phenylcarbamoyl)carbamimidothioate |
|---|---|
| PubChem CID | 54294265 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | methyl N'-(dimethylcarbamoyl)-N-(phenylcarbamoyl)carbamimidothioate |
| SMILES | CSC(=NC(=O)N(C)C)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H16N4O2S/c1-16(2)12(18)15-11(19-3)14-10(17)13-9-7-5-4-6-8-9/h4-8H,1-3H3,(H2,13,14,15,17,18) |
| InChIKey | RZRLDASBTANIKI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|