C18H26Cl2N4O2S — CID 54079841
methyl N'-(dibutylcarbamoyl)-N-[(3,4-dichlorophenyl)carbamoyl]carbamimidothioate (PubChem CID 54079841) has the molecular formula C18H26Cl2N4O2S and a molecular weight of 433.41 g/mol. Its IUPAC name is methyl N'-(dibutylcarbamoyl)-N-[(3,4-dichlorophenyl)carbamoyl]carbamimidothioate.
| Compound Name | methyl N'-(dibutylcarbamoyl)-N-[(3,4-dichlorophenyl)carbamoyl]carbamimidothioate |
|---|---|
| PubChem CID | 54079841 |
| Molecular Formula | C18H26Cl2N4O2S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | methyl N'-(dibutylcarbamoyl)-N-[(3,4-dichlorophenyl)carbamoyl]carbamimidothioate |
| SMILES | CCCCN(CCCC)C(=O)N=C(NC(=O)Nc1ccc(Cl)c(Cl)c1)SC |
| InChI | InChI=1S/C18H26Cl2N4O2S/c1-4-6-10-24(11-7-5-2)18(26)23-17(27-3)22-16(25)21-13-8-9-14(19)15(20)12-13/h8-9,12H,4-7,10-11H2,1-3H3,(H2,21,22,23,25,26) |
| InChIKey | MMHXSCGZIULCJE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|