C10H12Cl2N2S — CID 53364325
methyl N-(3,4-dichlorophenyl)-N'-ethylcarbamimidothioate (PubChem CID 53364325) has the molecular formula C10H12Cl2N2S and a molecular weight of 263.19 g/mol. Its IUPAC name is methyl N-(3,4-dichlorophenyl)-N'-ethylcarbamimidothioate.
| Compound Name | methyl N-(3,4-dichlorophenyl)-N'-ethylcarbamimidothioate |
|---|---|
| PubChem CID | 53364325 |
| Molecular Formula | C10H12Cl2N2S |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | methyl N-(3,4-dichlorophenyl)-N'-ethylcarbamimidothioate |
| SMILES | CC/N=C(/Nc1ccc(Cl)c(Cl)c1)SC |
| InChI | InChI=1S/C10H12Cl2N2S/c1-3-13-10(15-2)14-7-4-5-8(11)9(12)6-7/h4-6H,3H2,1-2H3,(H,13,14) |
| InChIKey | ZLZIYYCYDJFVPE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|