About butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate
butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate (PubChem CID 177482985) has the molecular formula C14H20Cl2N4S
and a molecular weight of 347.32 g/mol. Its IUPAC name is butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate.
Molecular Properties
| Compound Name | butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate |
| PubChem CID | 177482985 |
| Molecular Formula | C14H20Cl2N4S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate |
| SMILES | CCCCSC(/N=C(/N)Nc1ccc(Cl)c(Cl)c1)=N\CC |
| InChI | InChI=1S/C14H20Cl2N4S/c1-3-5-8-21-14(18-4-2)20-13(17)19-10-6-7-11(15)12(16)9-10/h6-7,9H,3-5,8H2,1-2H3,(H3,17,18,19,20) |
| InChIKey | UZXDHTARNVBQAB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate?
The IUPAC name of butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate (CID 177482985) is butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate.
What is the SMILES notation for butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate?
The canonical SMILES for butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate is CCCCSC(/N=C(/N)Nc1ccc(Cl)c(Cl)c1)=N\CC.
What is the InChIKey of butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate?
The InChIKey is UZXDHTARNVBQAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20Cl2N4S/c1-3-5-8-21-14(18-4-2)20-13(17)19-10-6-7-11(15)12(16)9-10/h6-7,9H,3-5,8H2,1-2H3,(H3,17,18,19,20).
What are the key properties of butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate?
butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate has a molecular weight of 347.32 g/mol, XLogP of 4.63, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-ethylcarbamimidothioate is sourced from PubChem (CID 177482985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).