C11H16Cl2N4 — CID 121224973
1-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]guanidine (PubChem CID 121224973) has the molecular formula C11H16Cl2N4 and a molecular weight of 275.18 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]guanidine.
| Compound Name | 1-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 121224973 |
| Molecular Formula | C11H16Cl2N4 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]guanidine |
| SMILES | CN(C)CC/N=C(\N)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H16Cl2N4/c1-17(2)6-5-15-11(14)16-8-3-4-9(12)10(13)7-8/h3-4,7H,5-6H2,1-2H3,(H3,14,15,16) |
| InChIKey | KUWCEWWIRGJZLZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|