About methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate
methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate (PubChem CID 177391347) has the molecular formula C17H26Cl2N4S
and a molecular weight of 389.40 g/mol. Its IUPAC name is methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate |
| PubChem CID | 177391347 |
| Molecular Formula | C17H26Cl2N4S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate |
| SMILES | CCCCCCCC/N=C(/N=C(/N)Nc1ccc(Cl)c(Cl)c1)SC |
| InChI | InChI=1S/C17H26Cl2N4S/c1-3-4-5-6-7-8-11-21-17(24-2)23-16(20)22-13-9-10-14(18)15(19)12-13/h9-10,12H,3-8,11H2,1-2H3,(H3,20,21,22,23) |
| InChIKey | NRUDLXLYUHXSCD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate?
The IUPAC name of methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate (CID 177391347) is methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate.
What is the SMILES notation for methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate?
The canonical SMILES for methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate is CCCCCCCC/N=C(/N=C(/N)Nc1ccc(Cl)c(Cl)c1)SC.
What is the InChIKey of methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate?
The InChIKey is NRUDLXLYUHXSCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26Cl2N4S/c1-3-4-5-6-7-8-11-21-17(24-2)23-16(20)22-13-9-10-14(18)15(19)12-13/h9-10,12H,3-8,11H2,1-2H3,(H3,20,21,22,23).
What are the key properties of methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate?
methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate has a molecular weight of 389.40 g/mol, XLogP of 5.80, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate is sourced from PubChem (CID 177391347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).