C17H26Cl2N4S — CID 177391347
methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate (PubChem CID 177391347) has the molecular formula C17H26Cl2N4S and a molecular weight of 389.40 g/mol. Its IUPAC name is methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate.
| Compound Name | methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate |
|---|---|
| PubChem CID | 177391347 |
| Molecular Formula | C17H26Cl2N4S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | methyl (NZ)-N-[amino-(3,4-dichloroanilino)methylidene]-N'-octylcarbamimidothioate |
| SMILES | CCCCCCCC/N=C(/N=C(/N)Nc1ccc(Cl)c(Cl)c1)SC |
| InChI | InChI=1S/C17H26Cl2N4S/c1-3-4-5-6-7-8-11-21-17(24-2)23-16(20)22-13-9-10-14(18)15(19)12-13/h9-10,12H,3-8,11H2,1-2H3,(H3,20,21,22,23) |
| InChIKey | NRUDLXLYUHXSCD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|