C14H23Cl2N5 — CID 45260161
(1E)-1-[amino-(4-chloroanilino)methylidene]-2-hexylguanidine;hydrochloride (PubChem CID 45260161) has the molecular formula C14H23Cl2N5 and a molecular weight of 332.28 g/mol. Its IUPAC name is (1E)-1-[amino-(4-chloroanilino)methylidene]-2-hexylguanidine;hydrochloride.
| Compound Name | (1E)-1-[amino-(4-chloroanilino)methylidene]-2-hexylguanidine;hydrochloride |
|---|---|
| PubChem CID | 45260161 |
| Molecular Formula | C14H23Cl2N5 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (1E)-1-[amino-(4-chloroanilino)methylidene]-2-hexylguanidine;hydrochloride |
| SMILES | CCCCCC/N=C(N)/N=C(\N)Nc1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C14H22ClN5.ClH/c1-2-3-4-5-10-18-13(16)20-14(17)19-12-8-6-11(15)7-9-12;/h6-9H,2-5,10H2,1H3,(H5,16,17,18,19,20);1H |
| InChIKey | PZPXLHAFVZZCSD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|