C11H16ClN5O — CID 70648810
1-[amino-(4-chloroanilino)methylidene]-2-(3-hydroxypropyl)guanidine (PubChem CID 70648810) has the molecular formula C11H16ClN5O and a molecular weight of 269.74 g/mol. Its IUPAC name is 1-[amino-(4-chloroanilino)methylidene]-2-(3-hydroxypropyl)guanidine.
| Compound Name | 1-[amino-(4-chloroanilino)methylidene]-2-(3-hydroxypropyl)guanidine |
|---|---|
| PubChem CID | 70648810 |
| Molecular Formula | C11H16ClN5O |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-[amino-(4-chloroanilino)methylidene]-2-(3-hydroxypropyl)guanidine |
| SMILES | NC(=N/C(N)=N/CCCO)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H16ClN5O/c12-8-2-4-9(5-3-8)16-11(14)17-10(13)15-6-1-7-18/h2-5,18H,1,6-7H2,(H5,13,14,15,16,17) |
| InChIKey | ODLDWDWIODLTPH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|