C26H36Cl2N10O6 — CID 71487845
(1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;2,3-dihydroxybutanedioic acid (PubChem CID 71487845) has the molecular formula C26H36Cl2N10O6 and a molecular weight of 655.54 g/mol. Its IUPAC name is (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;2,3-dihydroxybutanedioic acid.
| Compound Name | (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 71487845 |
| Molecular Formula | C26H36Cl2N10O6 |
| Molecular Weight | 655.54 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;2,3-dihydroxybutanedioic acid |
| SMILES | NC(=N\CCCCCC/N=C(N)/N=C(\N)Nc1ccc(Cl)cc1)/N=C(\N)Nc1ccc(Cl)cc1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C22H30Cl2N10.C4H6O6/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18;5-1(3(7)8)2(6)4(9)10/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | ODPMEZWIVVLYNJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 292.64 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.54 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|