C16H18ClN5 — CID 134125827
(1E)-1-[amino-(4-chloroanilino)methylidene]-2-(2-phenylethyl)guanidine (PubChem CID 134125827) has the molecular formula C16H18ClN5 and a molecular weight of 315.81 g/mol. Its IUPAC name is (1E)-1-[amino-(4-chloroanilino)methylidene]-2-(2-phenylethyl)guanidine.
| Compound Name | (1E)-1-[amino-(4-chloroanilino)methylidene]-2-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 134125827 |
| Molecular Formula | C16H18ClN5 |
| Molecular Weight | 315.81 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (1E)-1-[amino-(4-chloroanilino)methylidene]-2-(2-phenylethyl)guanidine |
| SMILES | NC(=N\CCc1ccccc1)/N=C(\N)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18ClN5/c17-13-6-8-14(9-7-13)21-16(19)22-15(18)20-11-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H5,18,19,20,21,22) |
| InChIKey | WERQRMXQAALSMV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|