C15H16ClN5 — CID 24835744
(1E)-1-[amino-(4-chloroanilino)methylidene]-2-benzylguanidine (PubChem CID 24835744) has the molecular formula C15H16ClN5 and a molecular weight of 301.78 g/mol. Its IUPAC name is (1E)-1-[amino-(4-chloroanilino)methylidene]-2-benzylguanidine.
| Compound Name | (1E)-1-[amino-(4-chloroanilino)methylidene]-2-benzylguanidine |
|---|---|
| PubChem CID | 24835744 |
| Molecular Formula | C15H16ClN5 |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (1E)-1-[amino-(4-chloroanilino)methylidene]-2-benzylguanidine |
| SMILES | NC(=N\Cc1ccccc1)/N=C(\N)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN5/c16-12-6-8-13(9-7-12)20-15(18)21-14(17)19-10-11-4-2-1-3-5-11/h1-9H,10H2,(H5,17,18,19,20,21) |
| InChIKey | ZVIUIVGUUTWJEC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|