C16H16F3N5 — CID 21492920
(1Z)-1-[amino-[4-(trifluoromethyl)anilino]methylidene]-2-benzylguanidine (PubChem CID 21492920) has the molecular formula C16H16F3N5 and a molecular weight of 335.33 g/mol. Its IUPAC name is (1Z)-1-[amino-[4-(trifluoromethyl)anilino]methylidene]-2-benzylguanidine.
| Compound Name | (1Z)-1-[amino-[4-(trifluoromethyl)anilino]methylidene]-2-benzylguanidine |
|---|---|
| PubChem CID | 21492920 |
| Molecular Formula | C16H16F3N5 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (1Z)-1-[amino-[4-(trifluoromethyl)anilino]methylidene]-2-benzylguanidine |
| SMILES | N/C(=N/C(N)=N/Cc1ccccc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3N5/c17-16(18,19)12-6-8-13(9-7-12)23-15(21)24-14(20)22-10-11-4-2-1-3-5-11/h1-9H,10H2,(H5,20,21,22,23,24) |
| InChIKey | IOSQIZXWSMOFKX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|