C22H20F3N3 — CID 135029912
1,2-dibenzyl-3-[4-(trifluoromethyl)phenyl]guanidine (PubChem CID 135029912) has the molecular formula C22H20F3N3 and a molecular weight of 383.42 g/mol. Its IUPAC name is 1,2-dibenzyl-3-[4-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 1,2-dibenzyl-3-[4-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 135029912 |
| Molecular Formula | C22H20F3N3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1,2-dibenzyl-3-[4-(trifluoromethyl)phenyl]guanidine |
| SMILES | FC(F)(F)c1ccc(N/C(=N/Cc2ccccc2)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20F3N3/c23-22(24,25)19-11-13-20(14-12-19)28-21(26-15-17-7-3-1-4-8-17)27-16-18-9-5-2-6-10-18/h1-14H,15-16H2,(H2,26,27,28) |
| InChIKey | SREXATLNLHTNNJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|